ChemNet > CAS > 6575-13-9 2,6-Dimethylbenzonitrile
6575-13-9 2,6-Dimethylbenzonitrile
| název výrobku |
2,6-Dimethylbenzonitrile |
| Synonyma |
2,6-Dimethylbenzoniitrile |
| Molekulární vzorec |
C9H9N |
| Molekulová hmotnost |
131.1745 |
| InChI |
InChI=1/C9H9N/c1-7-4-3-5-8(2)9(7)6-10/h3-5H,1-2H3 |
| Registrační číslo CAS |
6575-13-9 |
| EINECS |
229-503-5 |
| Molekulární struktura |
|
| Hustota |
0.99g/cm3 |
| Bod tání |
87-89℃ |
| Bod varu |
228.7°C at 760 mmHg |
| Index lomu |
1.525 |
| Bod vzplanutí |
91.9°C |
| Symbolů nebezpečnosti |
 Xn:Harmful;
|
| Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpečnostní Popis |
S36/37:Wear suitable protective clothing and gloves.;
|
|
