ChemNet > CAS > 6575-13-9 2,6-Dimethylbenzonitrile
6575-13-9 2,6-Dimethylbenzonitrile
název výrobku |
2,6-Dimethylbenzonitrile |
Synonyma |
2,6-Dimethylbenzoniitrile |
Molekulární vzorec |
C9H9N |
Molekulová hmotnost |
131.1745 |
InChI |
InChI=1/C9H9N/c1-7-4-3-5-8(2)9(7)6-10/h3-5H,1-2H3 |
Registrační číslo CAS |
6575-13-9 |
EINECS |
229-503-5 |
Molekulární struktura |
|
Hustota |
0.99g/cm3 |
Bod tání |
87-89℃ |
Bod varu |
228.7°C at 760 mmHg |
Index lomu |
1.525 |
Bod vzplanutí |
91.9°C |
Symbolů nebezpečnosti |
Xn:Harmful;
|
Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpečnostní Popis |
S36/37:Wear suitable protective clothing and gloves.;
|
|