ChemNet > CAS > 66298-09-7 2,4-Dimethylphenylthiosemicarbazide
66298-09-7 2,4-Dimethylphenylthiosemicarbazide
název výrobku |
2,4-Dimethylphenylthiosemicarbazide |
Synonyma |
4-(2,4-Dimethylphenyl)-3-thiosemicarbazide; N-(2,4-dimethylphenyl)hydrazinecarbothioamide |
Molekulární vzorec |
C9H13N3S |
Molekulová hmotnost |
195.2846 |
InChI |
InChI=1/C9H13N3S/c1-6-3-4-8(7(2)5-6)11-9(13)12-10/h3-5H,10H2,1-2H3,(H2,11,12,13) |
Registrační číslo CAS |
66298-09-7 |
Molekulární struktura |
|
Hustota |
1.228g/cm3 |
Bod varu |
310.5°C at 760 mmHg |
Index lomu |
1.678 |
Bod vzplanutí |
141.6°C |
Symbolů nebezpečnosti |
|
Riziko Codes |
R25:Toxic if swallowed.;
|
Bezpečnostní Popis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|