ChemNet > CAS > 68385-95-5 2-Amino-3,5-dibromobenzonitrile
68385-95-5 2-Amino-3,5-dibromobenzonitrile
| název výrobku |
2-Amino-3,5-dibromobenzonitrile |
| Molekulární vzorec |
C7H4Br2N2 |
| Molekulová hmotnost |
275.9281 |
| InChI |
InChI=1/C7H4Br2N2/c8-5-1-4(3-10)7(11)6(9)2-5/h1-2H,11H2 |
| Registrační číslo CAS |
68385-95-5 |
| Molekulární struktura |
|
| Hustota |
2.12g/cm3 |
| Bod tání |
160-163℃ |
| Bod varu |
301.2°C at 760 mmHg |
| Index lomu |
1.704 |
| Bod vzplanutí |
136°C |
| Symbolů nebezpečnosti |
 Xn:Harmful;
|
| Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpečnostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
