ChemNet > CAS > 693-16-3 2-Octylamine
693-16-3 2-Octylamine
| název výrobku |
2-Octylamine |
| Synonyma |
(+/-)-2-Aminooctane; (+/-)-1-Methylheptylamine~(+/-)-2-Octylamine; 1-Methylheptylamine; octan-2-amine; (2R)-octan-2-aminium; (2S)-octan-2-aminium; 2-Aminooctane |
| Molekulární vzorec |
C8H20N |
| Molekulová hmotnost |
130.2506 |
| InChI |
InChI=1/C8H19N/c1-3-4-5-6-7-8(2)9/h8H,3-7,9H2,1-2H3/p+1/t8-/m0/s1 |
| Registrační číslo CAS |
693-16-3 |
| EINECS |
211-744-2 |
| Molekulární struktura |
|
| Bod varu |
164°C at 760 mmHg |
| Bod vzplanutí |
50.6°C |
| Symbolů nebezpečnosti |
 Xi:Irritant;
|
| Riziko Codes |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpečnostní Popis |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
