ChemNet > CAS > 7145-82-6 2,4,6-Trichloroiodobenzene
7145-82-6 2,4,6-Trichloroiodobenzene
| název výrobku |
2,4,6-Trichloroiodobenzene |
| Synonyma |
2,4,5-Trichloroiodobenzene; 1-Iodo-2,4,5-trichlorobenzene; 1,2,4-trichloro-5-iodobenzene |
| Molekulární vzorec |
C6H2Cl3I |
| Molekulová hmotnost |
307.3435 |
| InChI |
InChI=1/C6H2Cl3I/c7-3-1-5(9)6(10)2-4(3)8/h1-2H |
| Registrační číslo CAS |
7145-82-6 |
| Molekulární struktura |
|
| Hustota |
2.085g/cm3 |
| Bod tání |
56-58℃ |
| Bod varu |
292.8°C at 760 mmHg |
| Index lomu |
1.651 |
| Bod vzplanutí |
130.9°C |
| Symbolů nebezpečnosti |
|
| Riziko Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpečnostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
