ChemNet > CAS > 95-63-6 1,2,4-Trimethylbenzene
95-63-6 1,2,4-Trimethylbenzene
| název výrobku |
1,2,4-Trimethylbenzene |
| Synonyma |
Pseudocumene; 1,2,4-Trimethylbenzere; 1,3,4-Trimethylbenzene |
| Molekulární vzorec |
C9H12 |
| Molekulová hmotnost |
120.19 |
| InChI |
InChI=1/C9H12/c1-7-4-5-8(2)9(3)6-7/h4-6H,1-3H3 |
| Registrační číslo CAS |
95-63-6 |
| EINECS |
202-436-9 |
| Molekulární struktura |
|
| Hustota |
0.88 |
| Bod tání |
-44℃ |
| Bod varu |
168℃ |
| Index lomu |
1.503-1.505 |
| Bod vzplanutí |
48℃ |
| Symbolů nebezpečnosti |
 Xn:Harmful;
 N:Dangerous for the environment;
|
| Riziko Codes |
R10:Flammable.;
R20:Harmful by inhalation.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R51/53:Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.;
|
| Bezpečnostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.;
|
|
