ChemNet > CAS > 1007-03-0 Cyclopropyl phenyl carbinol
1007-03-0 Cyclopropyl phenyl carbinol
| Produkt-Name |
Cyclopropyl phenyl carbinol |
| Synonyme |
alpha-Cyclopropylbenzenemethanol; Cyclopropyl phenyl carbinol~Cyclopropylphenylmethanol; alpha-Cyclopropylbenzyl alcohol; cyclopropyl(phenyl)methanol; (R)-cyclopropyl(phenyl)methanol; (S)-cyclopropyl(phenyl)methanol |
| Molekulare Formel |
C10H12O |
| Molecular Weight |
148.2017 |
| InChI |
InChI=1/C10H12O/c11-10(9-6-7-9)8-4-2-1-3-5-8/h1-5,9-11H,6-7H2/t10-/m1/s1 |
| CAS Registry Number |
1007-03-0 |
| EINECS |
213-749-5 |
| Molecular Structure |
|
| Dichte |
1.141g/cm3 |
| Siedepunkt |
248.9°C at 760 mmHg |
| Brechungsindex |
1.602 |
| Flammpunkt |
112.2°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
