ChemNet > CAS > 103-78-6 cyclohexylacetone
103-78-6 cyclohexylacetone
| Produkt-Name |
cyclohexylacetone |
| Synonyme |
Cyclohexylacetone, (Acetonylcyclohexane); Acetonylcyclohexane; Cyclohexyacetone; 1-cyclohexylpropan-2-one; 1-cyclohexylacetone |
| Molekulare Formel |
C9H16O |
| Molecular Weight |
140.2227 |
| InChI |
InChI=1/C9H16O/c1-8(10)7-9-5-3-2-4-6-9/h9H,2-7H2,1H3 |
| CAS Registry Number |
103-78-6 |
| EINECS |
203-143-9 |
| Molecular Structure |
|
| Dichte |
0.889g/cm3 |
| Siedepunkt |
188.1°C at 760 mmHg |
| Brechungsindex |
1.441 |
| Flammpunkt |
65.3°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
