ChemNet > CAS > 10401-11-3 3-Hydroxyphenylacetylene
10401-11-3 3-Hydroxyphenylacetylene
| Produkt-Name |
3-Hydroxyphenylacetylene |
| Synonyme |
3-Ethynylphenol |
| Molekulare Formel |
C8H6O |
| Molecular Weight |
118.1326 |
| InChI |
InChI=1/C8H6O/c1-2-7-4-3-5-8(9)6-7/h1,3-6,9H |
| CAS Registry Number |
10401-11-3 |
| Molecular Structure |
|
| Dichte |
1.12g/cm3 |
| Siedepunkt |
230.9°C at 760 mmHg |
| Brechungsindex |
1.589 |
| Flammpunkt |
106.1°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
