ChemNet > CAS > 108485-13-8 4-Bromo-2,3-dimethyl-6-nitroaniline
108485-13-8 4-Bromo-2,3-dimethyl-6-nitroaniline
| Produkt-Name |
4-Bromo-2,3-dimethyl-6-nitroaniline |
| Synonyme |
4-Bromo-6-nitro-2,3-xylidine |
| Molekulare Formel |
C8H9BrN2O2 |
| Molecular Weight |
245.0733 |
| InChI |
InChI=1/C8H9BrN2O2/c1-4-5(2)8(10)7(11(12)13)3-6(4)9/h3H,10H2,1-2H3 |
| CAS Registry Number |
108485-13-8 |
| Molecular Structure |
|
| Dichte |
1.609g/cm3 |
| Siedepunkt |
357.9°C at 760 mmHg |
| Brechungsindex |
1.632 |
| Flammpunkt |
170.3°C |
| Gefahrensymbole |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Beschreibung |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
