ChemNet > CAS > 112-61-8 Methyl stearate
112-61-8 Methyl stearate
| Produkt-Name |
Methyl stearate |
| Synonyme |
Methyl n-octadecanoate; Stearic acid methyl ester; methyl octadecanoate; Me-ST |
| Molekulare Formel |
C19H38O2 |
| Molecular Weight |
298.5038 |
| InChI |
InChI=1/C19H38O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h3-18H2,1-2H3 |
| CAS Registry Number |
112-61-8 |
| EINECS |
203-990-4 |
| Molecular Structure |
|
| Dichte |
0.863g/cm3 |
| Schmelzpunkt |
37-39℃ |
| Siedepunkt |
355.5°C at 760 mmHg |
| Brechungsindex |
1.444 |
| Flammpunkt |
169.3°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
