ChemNet > CAS > 1129-35-7 methyl 4-cyanobenzoate
1129-35-7 methyl 4-cyanobenzoate
| Produkt-Name |
methyl 4-cyanobenzoate |
| Synonyme |
4-Cyanobenzoic acid methyl ester; Cyanbenzoicacidmethylester; 4-Cy!nobenzoic acid methyl ester |
| Molekulare Formel |
C9H7NO2 |
| Molecular Weight |
161.1574 |
| InChI |
InChI=1/C9H7NO2/c1-12-9(11)8-4-2-7(6-10)3-5-8/h2-5H,1H3 |
| CAS Registry Number |
1129-35-7 |
| EINECS |
214-443-4 |
| Molecular Structure |
|
| Dichte |
1.18g/cm3 |
| Schmelzpunkt |
62℃ |
| Siedepunkt |
274.9°C at 760 mmHg |
| Brechungsindex |
1.535 |
| Flammpunkt |
131.2°C |
| Gefahrensymbole |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Beschreibung |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
