ChemNet > CAS > 116632-39-4 Bromoiodotoluene
116632-39-4 Bromoiodotoluene
| Produkt-Name |
Bromoiodotoluene |
| Synonyme |
5-Bromo-2-iodotoluene; 4-bromo-1-iodo-2-methylbenzene |
| Molekulare Formel |
C7H6BrI |
| Molecular Weight |
296.931 |
| InChI |
InChI=1/C7H6BrI/c1-5-4-6(8)2-3-7(5)9/h2-4H,1H3 |
| CAS Registry Number |
116632-39-4 |
| Molecular Structure |
|
| Dichte |
2.062g/cm3 |
| Siedepunkt |
264.2°C at 760 mmHg |
| Brechungsindex |
1.636 |
| Flammpunkt |
113.6°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
