ChemNet > CAS > 120-44-5 Desoxyanisoin
120-44-5 Desoxyanisoin
| Produkt-Name |
Desoxyanisoin |
| Synonyme |
4-Methoxy-2-(4-methoxyphenyl)acetophenone; Desoxyanisoin~4-Methoxybenzyl 4-methoxyphenyl ketone; 4,4-dimethoxydeoxybenzoin; 4-methoxybenzyl 4-methoxyphenyl ketone; Deoxyanisoin; 1,2-bis(4-methoxyphenyl)ethanone |
| Molekulare Formel |
C16H16O3 |
| Molecular Weight |
256.2964 |
| InChI |
InChI=1/C16H16O3/c1-18-14-7-3-12(4-8-14)11-16(17)13-5-9-15(19-2)10-6-13/h3-10H,11H2,1-2H3 |
| CAS Registry Number |
120-44-5 |
| EINECS |
204-396-8 |
| Molecular Structure |
|
| Dichte |
1.115g/cm3 |
| Schmelzpunkt |
109-112℃ |
| Siedepunkt |
415.6°C at 760 mmHg |
| Brechungsindex |
1.558 |
| Flammpunkt |
196.9°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
