ChemNet > CAS > 13191-36-1 2,5-Dibromo-3-methylthiophene
13191-36-1 2,5-Dibromo-3-methylthiophene
Produkt-Name |
2,5-Dibromo-3-methylthiophene |
Molekulare Formel |
C5H4Br2S |
Molecular Weight |
255.9583 |
InChI |
InChI=1/C5H4Br2S/c1-3-2-4(6)8-5(3)7/h2H,1H3 |
CAS Registry Number |
13191-36-1 |
EINECS |
236-147-4 |
Molecular Structure |
|
Dichte |
2.006g/cm3 |
Siedepunkt |
230.2°C at 760 mmHg |
Brechungsindex |
1.62 |
Flammpunkt |
93°C |
Gefahrensymbole |
|
Risk Codes |
R36/38:Irritating to eyes and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|