ChemNet > CAS > 132-86-5 1,3-Dihydroxynaphthalene
132-86-5 1,3-Dihydroxynaphthalene
| Produkt-Name |
1,3-Dihydroxynaphthalene |
| Synonyme |
1,3-Naphthalenediol; Naphthoresorcinol; naphtharesorcinol; NAPHTORESORCINE; naphthalene-1,3-diol |
| Molekulare Formel |
C10H8O2 |
| Molecular Weight |
160.1693 |
| InChI |
InChI=1/C10H8O2/c11-8-5-7-3-1-2-4-9(7)10(12)6-8/h1-6,11-12H |
| CAS Registry Number |
132-86-5 |
| EINECS |
205-079-7 |
| Molecular Structure |
|
| Dichte |
1.33g/cm3 |
| Schmelzpunkt |
123-126℃ |
| Siedepunkt |
361.5°C at 760 mmHg |
| Brechungsindex |
1.725 |
| Flammpunkt |
185.5°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
