ChemNet > CAS > 13265-84-4 D-glucal
13265-84-4 D-glucal
Produkt-Name |
D-glucal |
Synonyme |
1,5-Anhydro-2-deoxy-D-arabino-hex-1-enitol; D-arabino-Hex-1-enitol, 1,5-anhydro-2-deoxy-; (4xi)-1,5-anhydro-2-deoxy-D-threo-hex-1-enitol |
Molekulare Formel |
C6H10O4 |
Molecular Weight |
146.1412 |
InChI |
InChI=1/C6H10O4/c7-3-5-6(9)4(8)1-2-10-5/h1-2,4-9H,3H2/t4-,5-,6+/m1/s1 |
CAS Registry Number |
13265-84-4 |
EINECS |
236-259-3 |
Molecular Structure |
|
Dichte |
1.414g/cm3 |
Schmelzpunkt |
58-60℃ |
Siedepunkt |
325.5°C at 760 mmHg |
Brechungsindex |
1.565 |
Flammpunkt |
150.7°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|