ChemNet > CAS > 14199-83-8 1-Deoxy-1-nitro-D-mannitol
14199-83-8 1-Deoxy-1-nitro-D-mannitol
Produkt-Name |
1-Deoxy-1-nitro-D-mannitol |
Synonyme |
AI3-62628; D-Mannitol, 1-deoxy-1-nitro-; 1-deoxy-1-nitrohexitol |
Molekulare Formel |
C6H13NO7 |
Molecular Weight |
211.1699 |
InChI |
InChI=1/C6H13NO7/c8-2-4(10)6(12)5(11)3(9)1-7(13)14/h3-6,8-12H,1-2H2/t3-,4-,5-,6-/m1/s1 |
CAS Registry Number |
14199-83-8 |
EINECS |
238-051-8 |
Molecular Structure |
|
Dichte |
1.632g/cm3 |
Schmelzpunkt |
133℃ |
Siedepunkt |
608.3°C at 760 mmHg |
Brechungsindex |
1.585 |
Flammpunkt |
269°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|