ChemNet > CAS > 14804-31-0 Bromomethoxytoluene
14804-31-0 Bromomethoxytoluene
| Produkt-Name |
Bromomethoxytoluene |
| Synonyme |
5-Bromo-2-methoxytoluene; 4-Bromo-2-methylanisole; 4-bromo-1-methoxy-2-methylbenzene |
| Molekulare Formel |
C8H9BrO |
| Molecular Weight |
201.0605 |
| InChI |
InChI=1/C8H9BrO/c1-6-5-7(9)3-4-8(6)10-2/h3-5H,1-2H3 |
| CAS Registry Number |
14804-31-0 |
| Molecular Structure |
|
| Dichte |
1.378g/cm3 |
| Schmelzpunkt |
66-69℃ |
| Siedepunkt |
226.1°C at 760 mmHg |
| Brechungsindex |
1.535 |
| Flammpunkt |
102.3°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
