ChemNet > CAS > 1483-27-8 2,5-Dimethoxythiophenol
1483-27-8 2,5-Dimethoxythiophenol
| Produkt-Name |
2,5-Dimethoxythiophenol |
| Synonyme |
2,5-Dimethoxybenzenethiol |
| Molekulare Formel |
C8H10O2S |
| Molecular Weight |
170.2288 |
| InChI |
InChI=1/C8H10O2S/c1-9-6-3-4-7(10-2)8(11)5-6/h3-5,11H,1-2H3 |
| CAS Registry Number |
1483-27-8 |
| Molecular Structure |
|
| Dichte |
1.134g/cm3 |
| Siedepunkt |
278.8°C at 760 mmHg |
| Brechungsindex |
1.549 |
| Flammpunkt |
122.4°C |
| Gefahrensymbole |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
