Produkt-Name |
Dibenzo-30-crown-10 |
Synonyme |
Dibenzo-30-crown 10-ether; 6,7,9,10,12,13,15,16,23,24,26,27,29,30,32,33-hexadecahydrodibenzo[b,q][1,4,7,10,13,16,19,22,25,28]decaoxacyclotriacontine |
Molekulare Formel |
C28H40O10 |
Molecular Weight |
536.6112 |
InChI |
InChI=1/C28H40O10/c1-2-6-26-25(5-1)35-21-17-31-13-9-29-11-15-33-19-23-37-27-7-3-4-8-28(27)38-24-20-34-16-12-30-10-14-32-18-22-36-26/h1-8H,9-24H2 |
CAS Registry Number |
17455-25-3 |
Molecular Structure |
|
Dichte |
1.068g/cm3 |
Schmelzpunkt |
104℃ |
Siedepunkt |
671°C at 760 mmHg |
Brechungsindex |
1.465 |
Flammpunkt |
259°C |
Gefahrensymbole |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|