ChemNet > CAS > 175204-06-5 2-Fluoro-6-phenoxybenzonitrile
175204-06-5 2-Fluoro-6-phenoxybenzonitrile
| Produkt-Name |
2-Fluoro-6-phenoxybenzonitrile |
| Synonyme |
2-Fluoro-6-phenyloxybenzonitrile |
| Molekulare Formel |
C13H8FNO |
| Molecular Weight |
213.2071 |
| InChI |
InChI=1/C13H8FNO/c14-12-7-4-8-13(11(12)9-15)16-10-5-2-1-3-6-10/h1-8H |
| CAS Registry Number |
175204-06-5 |
| Molecular Structure |
|
| Dichte |
1.24g/cm3 |
| Schmelzpunkt |
90-93℃ |
| Siedepunkt |
308.5°C at 760 mmHg |
| Brechungsindex |
1.591 |
| Flammpunkt |
140.4°C |
| Gefahrensymbole |
|
| Risk Codes |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
