ChemNet > CAS > 175277-20-0 methyl 4-(1-hydroxyiminoethyl)-5-methylisoxazole-3-carboxylate
175277-20-0 methyl 4-(1-hydroxyiminoethyl)-5-methylisoxazole-3-carboxylate
Produkt-Name |
methyl 4-(1-hydroxyiminoethyl)-5-methylisoxazole-3-carboxylate |
Synonyme |
methyl 4-(N-hydroxyethanimidoyl)-5-methylisoxazole-3-carboxylate |
Molekulare Formel |
C8H10N2O4 |
Molecular Weight |
198.176 |
InChI |
InChI=1/C8H10N2O4/c1-4(9-12)6-5(2)14-10-7(6)8(11)13-3/h12H,1-3H3 |
CAS Registry Number |
175277-20-0 |
Molecular Structure |
|
Dichte |
1.34g/cm3 |
Schmelzpunkt |
121℃ |
Siedepunkt |
389.3°C at 760 mmHg |
Brechungsindex |
1.549 |
Flammpunkt |
189.2°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|