ChemNet > CAS > 1766-76-3 decafluorobenzhydrol
1766-76-3 decafluorobenzhydrol
Produkt-Name |
decafluorobenzhydrol |
Synonyme |
Bis(pentafluorophenyl) carbinol; Bis(pentafluorophenyl)methanol; bis(pentafluorophenyl)methanol |
Molekulare Formel |
C13H2F10O |
Molecular Weight |
364.1384 |
InChI |
InChI=1/C13H2F10O/c14-3-1(4(15)8(19)11(22)7(3)18)13(24)2-5(16)9(20)12(23)10(21)6(2)17/h13,24H |
CAS Registry Number |
1766-76-3 |
EINECS |
217-185-0 |
Molecular Structure |
|
Dichte |
1.74g/cm3 |
Schmelzpunkt |
76-80℃ |
Siedepunkt |
265.2°C at 760 mmHg |
Brechungsindex |
1.457 |
Flammpunkt |
114.2°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|