ChemNet > CAS > 180-84-7 1,7-Dioxaspiro(5.5)undecane
180-84-7 1,7-Dioxaspiro(5.5)undecane
Produkt-Name |
1,7-Dioxaspiro(5.5)undecane |
Synonyme |
Dioxaspiroundecane |
Molekulare Formel |
C9H16O2 |
Molecular Weight |
156.2221 |
InChI |
InChI=1/C9H16O2/c1-3-7-10-9(5-1)6-2-4-8-11-9/h1-8H2 |
CAS Registry Number |
180-84-7 |
EINECS |
205-870-7 |
Molecular Structure |
|
Dichte |
1.02g/cm3 |
Siedepunkt |
193.5°C at 760 mmHg |
Brechungsindex |
1.475 |
Flammpunkt |
63.9°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|