ChemNet > CAS > 18984-21-9 2,4-Dichloro-beta-nitrostyrene
18984-21-9 2,4-Dichloro-beta-nitrostyrene
Produkt-Name |
2,4-Dichloro-beta-nitrostyrene |
Synonyme |
1-(2,4-Dichlorophenyl)-2-nitroethene; 2,4-dichloro-1-(2-nitroethenyl)benzene; 2,4-dichloro-1-[(E)-2-nitroethenyl]benzene |
Molekulare Formel |
C8H5Cl2NO2 |
Molecular Weight |
218.0368 |
InChI |
InChI=1/C8H5Cl2NO2/c9-7-2-1-6(8(10)5-7)3-4-11(12)13/h1-5H/b4-3+ |
CAS Registry Number |
18984-21-9 |
Molecular Structure |
|
Dichte |
1.447g/cm3 |
Siedepunkt |
334.1°C at 760 mmHg |
Brechungsindex |
1.626 |
Flammpunkt |
155.9°C |
Gefahrensymbole |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|