ChemNet > CAS > 19054-57-0 2-hydroxybutyric acid sodium salt
19054-57-0 2-hydroxybutyric acid sodium salt
Produkt-Name |
2-hydroxybutyric acid sodium salt |
Synonyme |
sodium 2-hydroxybutanoate; sodium(S)-2-hydroxybutanoate |
Molekulare Formel |
C4H7NaO3 |
Molecular Weight |
126.0863 |
InChI |
InChI=1/C4H8O3.Na/c1-2-3(5)4(6)7;/h3,5H,2H2,1H3,(H,6,7);/q;+1/p-1/t3-;/m1./s1 |
CAS Registry Number |
19054-57-0 |
EINECS |
242-788-0 |
Molecular Structure |
|
Siedepunkt |
238.3°C at 760 mmHg |
Flammpunkt |
112.2°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|