ChemNet > CAS > 19952-47-7 2-Amino-4-chlorobenzothiazole
19952-47-7 2-Amino-4-chlorobenzothiazole
Produkt-Name |
2-Amino-4-chlorobenzothiazole |
Synonyme |
4-chloro-1,3-benzothiazol-2-ylamine; 4-chlorobenzo[d]thiazol-2-amine; 4-chloro-1,3-benzothiazol-2-amine |
Molekulare Formel |
C7H5ClN2S |
Molecular Weight |
184.646 |
InChI |
InChI=1/C7H5ClN2S/c8-4-2-1-3-5-6(4)10-7(9)11-5/h1-3H,(H2,9,10) |
CAS Registry Number |
19952-47-7 |
EINECS |
243-439-5 |
Molecular Structure |
|
Dichte |
1.532g/cm3 |
Schmelzpunkt |
203-208℃ |
Siedepunkt |
344.3°C at 760 mmHg |
Brechungsindex |
1.762 |
Flammpunkt |
162°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|