ChemNet > CAS > 20028-53-9 2-Amino-5-chlorobenzaldehyde
20028-53-9 2-Amino-5-chlorobenzaldehyde
| Produkt-Name |
2-Amino-5-chlorobenzaldehyde |
| Synonyme |
6-Amino-3-chlorobenzaldehyde |
| Molekulare Formel |
C7H6ClNO |
| Molecular Weight |
155.5816 |
| InChI |
InChI=1/C7H6ClNO/c8-6-1-2-7(9)5(3-6)4-10/h1-4H,9H2 |
| CAS Registry Number |
20028-53-9 |
| Molecular Structure |
|
| Dichte |
1.348g/cm3 |
| Siedepunkt |
288.1°C at 760 mmHg |
| Brechungsindex |
1.651 |
| Flammpunkt |
128°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
