ChemNet > CAS > 2043-06-3 2,5-bis(4-biphenylyl)-1,3,4-oxadiazole
2043-06-3 2,5-bis(4-biphenylyl)-1,3,4-oxadiazole
Produkt-Name |
2,5-bis(4-biphenylyl)-1,3,4-oxadiazole |
Synonyme |
BBOD; 2,5-di(biphenyl-4-yl)-1,3,4-oxadiazole |
Molekulare Formel |
C26H18N2O |
Molecular Weight |
374.4339 |
InChI |
InChI=1/C26H18N2O/c1-3-7-19(8-4-1)21-11-15-23(16-12-21)25-27-28-26(29-25)24-17-13-22(14-18-24)20-9-5-2-6-10-20/h1-18H |
CAS Registry Number |
2043-06-3 |
EINECS |
218-046-7 |
Molecular Structure |
|
Dichte |
1.17g/cm3 |
Schmelzpunkt |
235-238℃ |
Siedepunkt |
568.8°C at 760 mmHg |
Brechungsindex |
1.625 |
Flammpunkt |
290.8°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|