ChemNet > CAS > 20485-41-0 4-methylthiazole-5-carboxylic acid
20485-41-0 4-methylthiazole-5-carboxylic acid
| Produkt-Name |
4-methylthiazole-5-carboxylic acid |
| Synonyme |
4-Methyl-thiazole-5-carboxylic acid; 4-Methylthiazole-5-Carboxylate; 4-methyl-1,3-thiazole-5-carboxylic acid; 4-Methyl-5-thiazolecarboxylic acid |
| Molekulare Formel |
C10H9NO |
| Molecular Weight |
159.1846 |
| InChI |
InChI=1/C10H9NO/c1-12-10-3-2-9-7-11-5-4-8(9)6-10/h2-7H,1H3 |
| CAS Registry Number |
20485-41-0 |
| Molecular Structure |
|
| Dichte |
1.131g/cm3 |
| Schmelzpunkt |
250℃ |
| Siedepunkt |
295.593°C at 760 mmHg |
| Brechungsindex |
1.611 |
| Flammpunkt |
108.428°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
