ChemNet > CAS > 20513-98-8 D-Glucorono-6,3-lactone acetonide
20513-98-8 D-Glucorono-6,3-lactone acetonide
| Produkt-Name |
D-Glucorono-6,3-lactone acetonide |
| Synonyme |
D-Glucurono-6,3-lactone acetonide; 6-hydroxy-2,2-dimethyltetrahydrofuro[2',3':4,5]furo[2,3-d][1,3]dioxol-5(3bH)-one (non-preferred name) |
| Molekulare Formel |
C9H12O6 |
| Molecular Weight |
216.188 |
| InChI |
InChI=1/C9H12O6/c1-9(2)14-6-5-4(13-8(6)15-9)3(10)7(11)12-5/h3-6,8,10H,1-2H3 |
| CAS Registry Number |
20513-98-8 |
| Molecular Structure |
|
| Dichte |
1.41g/cm3 |
| Siedepunkt |
386°C at 760 mmHg |
| Brechungsindex |
1.51 |
| Flammpunkt |
158.8°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
