ChemNet > CAS > 20949-81-9 2-phenyl-1,3-thiazole-4-carbaldehyde
20949-81-9 2-phenyl-1,3-thiazole-4-carbaldehyde
| Produkt-Name |
2-phenyl-1,3-thiazole-4-carbaldehyde |
| Synonyme |
2-phenylthiazole-4-carbaldehyde |
| Molekulare Formel |
C10H7NOS |
| Molecular Weight |
189.2337 |
| InChI |
InChI=1/C10H7NOS/c12-6-9-7-13-10(11-9)8-4-2-1-3-5-8/h1-7H |
| CAS Registry Number |
20949-81-9 |
| Molecular Structure |
|
| Dichte |
1.269g/cm3 |
| Schmelzpunkt |
45℃ |
| Siedepunkt |
353°C at 760 mmHg |
| Brechungsindex |
1.645 |
| Flammpunkt |
167.3°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
