ChemNet > CAS > 21018-38-2 1-Methallyl-3-methyl-2-thiourea
21018-38-2 1-Methallyl-3-methyl-2-thiourea
Produkt-Name |
1-Methallyl-3-methyl-2-thiourea |
Synonyme |
1-methyl-3-(2-methylprop-2-enyl)-2-thiourea; 1-methyl-3-(2-methylprop-2-en-1-yl)thiourea |
Molekulare Formel |
C6H12N2S |
Molecular Weight |
144.2379 |
InChI |
InChI=1/C6H12N2S/c1-5(2)4-8-6(9)7-3/h1,4H2,2-3H3,(H2,7,8,9) |
CAS Registry Number |
21018-38-2 |
EINECS |
244-150-7 |
Molecular Structure |
|
Dichte |
0.994g/cm3 |
Schmelzpunkt |
60-64℃ |
Siedepunkt |
189.7°C at 760 mmHg |
Brechungsindex |
1.516 |
Flammpunkt |
68.5°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|