ChemNet > CAS > 2150-89-2 N-(3-Chlorophenyl)urethane
2150-89-2 N-(3-Chlorophenyl)urethane
| Produkt-Name |
N-(3-Chlorophenyl)urethane |
| Synonyme |
Ethyl 3-chlorocarbanilate~Ethyl N-(3-chlorophenyl) carbamate; ethyl (3-chlorophenyl)carbamate |
| Molekulare Formel |
C9H10ClNO2 |
| Molecular Weight |
199.6342 |
| InChI |
InChI=1/C9H10ClNO2/c1-2-13-9(12)11-8-5-3-4-7(10)6-8/h3-6H,2H2,1H3,(H,11,12) |
| CAS Registry Number |
2150-89-2 |
| Molecular Structure |
|
| Dichte |
1.268g/cm3 |
| Siedepunkt |
238.5°C at 760 mmHg |
| Brechungsindex |
1.572 |
| Flammpunkt |
98°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
