ChemNet > CAS > 2265-91-0 1,3-Difluoro-5-iodobenzene
2265-91-0 1,3-Difluoro-5-iodobenzene
| Produkt-Name |
1,3-Difluoro-5-iodobenzene |
| Synonyme |
3,5-DIFLUOROIODOBENZENE; 3,5-Difluoro iodobenzene |
| Molekulare Formel |
C6H3F2I |
| Molecular Weight |
239.9893 |
| InChI |
InChI=1/C6H3F2I/c7-4-1-5(8)3-6(9)2-4/h1-3H |
| CAS Registry Number |
2265-91-0 |
| Molecular Structure |
|
| Dichte |
2.001g/cm3 |
| Siedepunkt |
173.9°C at 760 mmHg |
| Brechungsindex |
1.566 |
| Flammpunkt |
63.8°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
