ChemNet > CAS > 2307-10-0 S-n-Propyl thioacetate
2307-10-0 S-n-Propyl thioacetate
| Produkt-Name |
S-n-Propyl thioacetate |
| Synonyme |
Thioacetic acid S-n-propyl ester; S-propyl ethanethioate; Propyl thioacetate |
| Molekulare Formel |
C5H10OS |
| Molecular Weight |
118.1973 |
| InChI |
InChI=1/C5H10OS/c1-3-4-7-5(2)6/h3-4H2,1-2H3 |
| CAS Registry Number |
2307-10-0 |
| EINECS |
218-984-7 |
| Molecular Structure |
|
| Dichte |
0.967g/cm3 |
| Siedepunkt |
141.4°C at 760 mmHg |
| Brechungsindex |
1.456 |
| Flammpunkt |
36°C |
| Gefahrensymbole |
|
| Risk Codes |
R10:Flammable.;
|
| Safety Beschreibung |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
