ChemNet > CAS > 23147-58-2 glycolaldehyde dimer, mixture of stereoisomers
23147-58-2 glycolaldehyde dimer, mixture of stereoisomers
Produkt-Name |
glycolaldehyde dimer, mixture of stereoisomers |
Synonyme |
Glycolaldehyde dimer; Hydroxy Acetaldehyde; 1,4-dioxane-2,5-diol; 2,5-Dihydroxy-1,4-dioxane |
Molekulare Formel |
C4H8O4 |
Molecular Weight |
120.1039 |
InChI |
InChI=1/C4H8O4/c5-3-1-7-4(6)2-8-3/h3-6H,1-2H2 |
CAS Registry Number |
23147-58-2 |
Molecular Structure |
|
Dichte |
1.455g/cm3 |
Schmelzpunkt |
85℃ |
Siedepunkt |
312.4°C at 760 mmHg |
Brechungsindex |
1.513 |
Flammpunkt |
142.8°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
|
|