ChemNet > CAS > 24800-44-0 Tripropylene glycol
24800-44-0 Tripropylene glycol
| Produkt-Name |
Tripropylene glycol |
| Synonyme |
Tripropylene glycol (mixture of isomers); Tripropyleneglycol,90%; Tripropyleneglycol; TPG; 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol; 3,3'-[propane-1,2-diylbis(oxy)]dipropan-1-ol; tripropylene glycol, mixture of isomers |
| Molekulare Formel |
C9H20O4 |
| Molecular Weight |
192.2527 |
| InChI |
InChI=1/C9H20O4/c1-9(13-7-3-5-11)8-12-6-2-4-10/h9-11H,2-8H2,1H3 |
| CAS Registry Number |
24800-44-0 |
| EINECS |
246-466-0 |
| Molecular Structure |
|
| Dichte |
1.038g/cm3 |
| Siedepunkt |
316.1°C at 760 mmHg |
| Brechungsindex |
1.455 |
| Flammpunkt |
145°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
|
|
