ChemNet > CAS > 25952-74-3 3,5-dibromo-4-hydroxybenzaldehyde oxime
25952-74-3 3,5-dibromo-4-hydroxybenzaldehyde oxime
| Produkt-Name |
3,5-dibromo-4-hydroxybenzaldehyde oxime |
| Synonyme |
2,6-dibromo-4-[(E)-(hydroxyimino)methyl]phenol |
| Molekulare Formel |
C7H5Br2NO2 |
| Molecular Weight |
294.9281 |
| InChI |
InChI=1/C7H5Br2NO2/c8-5-1-4(3-10-12)2-6(9)7(5)11/h1-3,11-12H/b10-3+ |
| CAS Registry Number |
25952-74-3 |
| Molecular Structure |
|
| Dichte |
2.091g/cm3 |
| Schmelzpunkt |
198℃ |
| Siedepunkt |
311.907°C at 760 mmHg |
| Brechungsindex |
1.661 |
| Flammpunkt |
142.436°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
