ChemNet > CAS > 26260-02-6 2-Iodobenzaldehyde
26260-02-6 2-Iodobenzaldehyde
| Produkt-Name |
2-Iodobenzaldehyde |
| Synonyme |
Benzaldehyde, 2-iodo- |
| Molekulare Formel |
C7H5IO |
| Molecular Weight |
232.0185 |
| InChI |
InChI=1/C7H5IO/c8-7-4-2-1-3-6(7)5-9/h1-5H |
| CAS Registry Number |
26260-02-6 |
| Molecular Structure |
|
| Dichte |
1.883g/cm3 |
| Schmelzpunkt |
36-39℃ |
| Siedepunkt |
266.3°C at 760 mmHg |
| Brechungsindex |
1.668 |
| Flammpunkt |
114.8°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
