ChemNet > CAS > 2642-98-0 6-Aminochrysene
2642-98-0 6-Aminochrysene
Produkt-Name |
6-Aminochrysene |
Synonyme |
6-Chrysenamine; chrysen-6-ylamine; chrysen-6-amine |
Molekulare Formel |
C18H13N |
Molecular Weight |
243.3025 |
InChI |
InChI=1/C18H13N/c19-18-11-17-13-6-2-1-5-12(13)9-10-15(17)14-7-3-4-8-16(14)18/h1-11H,19H2 |
CAS Registry Number |
2642-98-0 |
EINECS |
220-149-7 |
Molecular Structure |
|
Dichte |
1.253g/cm3 |
Schmelzpunkt |
206-211℃ |
Siedepunkt |
501.2°C at 760 mmHg |
Brechungsindex |
1.813 |
Flammpunkt |
286.9°C |
Gefahrensymbole |
Xn:Harmful;
|
Risk Codes |
|
Safety Beschreibung |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|