ChemNet > CAS > 27339-38-4 3-Formylfuran-2-boronic acid
27339-38-4 3-Formylfuran-2-boronic acid
| Produkt-Name |
3-Formylfuran-2-boronic acid |
| Synonyme |
2-Borono-3-furaldehyde; (3-formylfuran-2-yl)boronic acid |
| Molekulare Formel |
C5H5BO4 |
| Molecular Weight |
139.9018 |
| InChI |
InChI=1/C5H5BO4/c7-3-4-1-2-10-5(4)6(8)9/h1-3,8-9H |
| CAS Registry Number |
27339-38-4 |
| Molecular Structure |
|
| Dichte |
1.36g/cm3 |
| Siedepunkt |
346.6°C at 760 mmHg |
| Brechungsindex |
1.51 |
| Flammpunkt |
163.4°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
