ChemNet > CAS > 30742-59-7 5-nitro-2-pyrrolidin-1-yl-benzaldehyde
30742-59-7 5-nitro-2-pyrrolidin-1-yl-benzaldehyde
| Produkt-Name |
5-nitro-2-pyrrolidin-1-yl-benzaldehyde |
| Molekulare Formel |
C11H12N2O3 |
| Molecular Weight |
220.2246 |
| InChI |
InChI=1/C11H12N2O3/c14-8-9-7-10(13(15)16)3-4-11(9)12-5-1-2-6-12/h3-4,7-8H,1-2,5-6H2 |
| CAS Registry Number |
30742-59-7 |
| Molecular Structure |
|
| Dichte |
1.314g/cm3 |
| Schmelzpunkt |
136℃ |
| Siedepunkt |
402.1°C at 760 mmHg |
| Brechungsindex |
1.632 |
| Flammpunkt |
197°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
