ChemNet > CAS > 30955-94-3 2-Acetyl-5-iodothiophene
30955-94-3 2-Acetyl-5-iodothiophene
| Produkt-Name |
2-Acetyl-5-iodothiophene |
| Synonyme |
NSC 80387; 1-(5-iodothiophen-2-yl)ethanone |
| Molekulare Formel |
C6H5IOS |
| Molecular Weight |
252.0728 |
| InChI |
InChI=1/C6H5IOS/c1-4(8)5-2-3-6(7)9-5/h2-3H,1H3 |
| CAS Registry Number |
30955-94-3 |
| Molecular Structure |
|
| Dichte |
1.902g/cm3 |
| Siedepunkt |
306.2°C at 760 mmHg |
| Brechungsindex |
1.637 |
| Flammpunkt |
139°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
