ChemNet > CAS > 31604-39-4 N-(4-Nitrophenyl)phthalimide
31604-39-4 N-(4-Nitrophenyl)phthalimide
Produkt-Name |
N-(4-Nitrophenyl)phthalimide |
Synonyme |
N-(4-Nitrophenyl)-phthalamide; 2-(4-nitrophenyl)-1H-isoindole-1,3(2H)-dione |
Molekulare Formel |
C14H8N2O4 |
Molecular Weight |
268.2243 |
InChI |
InChI=1/C14H8N2O4/c17-13-11-3-1-2-4-12(11)14(18)15(13)9-5-7-10(8-6-9)16(19)20/h1-8H |
CAS Registry Number |
31604-39-4 |
Molecular Structure |
|
Dichte |
1.501g/cm3 |
Siedepunkt |
494.2°C at 760 mmHg |
Brechungsindex |
1.694 |
Flammpunkt |
252.7°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|