ChemNet > CAS > 32690-28-1 4,5-Dinitro-o-phenylenediamine
32690-28-1 4,5-Dinitro-o-phenylenediamine
| Produkt-Name |
4,5-Dinitro-o-phenylenediamine |
| Synonyme |
4,5-Dinitro-1,2-diaminobenzene; 4,5-dinitrobenzene-1,2-diamine |
| Molekulare Formel |
C6H6N4O4 |
| Molecular Weight |
198.1362 |
| InChI |
InChI=1/C6H6N4O4/c7-3-1-5(9(11)12)6(10(13)14)2-4(3)8/h1-2H,7-8H2 |
| CAS Registry Number |
32690-28-1 |
| Molecular Structure |
|
| Dichte |
1.683g/cm3 |
| Schmelzpunkt |
213℃ |
| Siedepunkt |
541.1°C at 760 mmHg |
| Brechungsindex |
1.747 |
| Flammpunkt |
281°C |
| Gefahrensymbole |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Beschreibung |
S36/37:Wear suitable protective clothing and gloves.;
|
|
