ChemNet > CAS > 33143-29-2 2,2-dimethyl-2H-chromene-6-carbonitrile
33143-29-2 2,2-dimethyl-2H-chromene-6-carbonitrile
Produkt-Name |
2,2-dimethyl-2H-chromene-6-carbonitrile |
Synonyme |
2,2-Dimethyl-2H-chromeme-6-carbonitrile |
Molekulare Formel |
C12H11NO |
Molecular Weight |
185.2218 |
InChI |
InChI=1/C12H11NO/c1-12(2)6-5-10-7-9(8-13)3-4-11(10)14-12/h3-7H,1-2H3 |
CAS Registry Number |
33143-29-2 |
Molecular Structure |
|
Dichte |
1.13g/cm3 |
Schmelzpunkt |
48℃ |
Siedepunkt |
301°C at 760 mmHg |
Brechungsindex |
1.578 |
Flammpunkt |
126.8°C |
Gefahrensymbole |
Xn:Harmful;
|
Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Safety Beschreibung |
S36/37:Wear suitable protective clothing and gloves.;
|
|