ChemNet > CAS > 332-77-4 2,5-Dimethoxy-2,5-dihydrofuran, mixture ofcis and trans
332-77-4 2,5-Dimethoxy-2,5-dihydrofuran, mixture ofcis and trans
| Produkt-Name |
2,5-Dimethoxy-2,5-dihydrofuran, mixture ofcis and trans |
| Synonyme |
2,5-Dihydro-2,5-dimethoxyfuran; 2,5-Dimethoxy-2,5-dihydrofuran; (2R,5R)-2,5-dimethoxy-2,5-dihydrofuran; (2R,5S)-2,5-dimethoxy-2,5-dihydrofuran; (2S,5S)-2,5-dimethoxy-2,5-dihydrofuran |
| Molekulare Formel |
C6H10O3 |
| Molecular Weight |
130.1418 |
| InChI |
InChI=1/C6H10O3/c1-7-5-3-4-6(8-2)9-5/h3-6H,1-2H3/t5-,6-/m0/s1 |
| CAS Registry Number |
332-77-4 |
| EINECS |
206-367-5 |
| Molecular Structure |
|
| Dichte |
1.06g/cm3 |
| Siedepunkt |
161°C at 760 mmHg |
| Brechungsindex |
1.448 |
| Flammpunkt |
47.2°C |
| Gefahrensymbole |
 Xn:Harmful;
|
| Risk Codes |
R10:;
|
| Safety Beschreibung |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S39:Wear eye/face protection.;
|
|
