ChemNet > CAS > 337508-71-1 2,3-dihydro-1,4-benzodioxine-6-carbothioamide
337508-71-1 2,3-dihydro-1,4-benzodioxine-6-carbothioamide
| Produkt-Name |
2,3-dihydro-1,4-benzodioxine-6-carbothioamide |
| Synonyme |
2,3-dihydro-4-Benzodioxin-6-carbothioamide |
| Molekulare Formel |
C9H9NO2S |
| Molecular Weight |
195.2383 |
| InChI |
InChI=1/C9H9NO2S/c10-9(13)6-1-2-7-8(5-6)12-4-3-11-7/h1-2,5H,3-4H2,(H2,10,13) |
| CAS Registry Number |
337508-71-1 |
| Molecular Structure |
|
| Dichte |
1.347g/cm3 |
| Schmelzpunkt |
140.2℃ |
| Siedepunkt |
339.2°C at 760 mmHg |
| Brechungsindex |
1.655 |
| Flammpunkt |
158.9°C |
| Gefahrensymbole |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Beschreibung |
S36/37:Wear suitable protective clothing and gloves.;
|
|
